C19H22ClFN4O2S — CID 87279098
N-[[(6S,7R)-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methyl]-3-(methylsulfanylamino)pyridine-2-carboxamide (PubChem CID 87279098) has the molecular formula C19H22ClFN4O2S and a molecular weight of 424.93 g/mol. Its IUPAC name is N-[[(6S,7R)-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methyl]-3-(methylsulfanylamino)pyridine-2-carboxamide.
| Compound Name | N-[[(6S,7R)-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methyl]-3-(methylsulfanylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 87279098 |
| Molecular Formula | C19H22ClFN4O2S |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | N-[[(6S,7R)-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methyl]-3-(methylsulfanylamino)pyridine-2-carboxamide |
| SMILES | CSNc1cccnc1C(=O)NC[C@@H]1CNCCO[C@H]1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C19H22ClFN4O2S/c1-28-25-16-3-2-6-23-17(16)19(26)24-11-13-10-22-7-8-27-18(13)12-4-5-14(20)15(21)9-12/h2-6,9,13,18,22,25H,7-8,10-11H2,1H3,(H,24,26)/t13-,18-/m0/s1 |
| InChIKey | OFADFPDTDZMGBN-UGSOOPFHSA-N |
| XLogP | 3.27 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|