About formaldehyde;2-[1-(3-methylbut-2-enyl)cyclopropyl]acetaldehyde
formaldehyde;2-[1-(3-methylbut-2-enyl)cyclopropyl]acetaldehyde (PubChem CID 87279246) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is formaldehyde;2-[1-(3-methylbut-2-enyl)cyclopropyl]acetaldehyde.
Molecular Properties
| Compound Name | formaldehyde;2-[1-(3-methylbut-2-enyl)cyclopropyl]acetaldehyde |
| PubChem CID | 87279246 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | formaldehyde;2-[1-(3-methylbut-2-enyl)cyclopropyl]acetaldehyde |
| SMILES | C=O.CC(C)=CCC1(CC=O)CC1 |
| InChI | InChI=1S/C10H16O.CH2O/c1-9(2)3-4-10(5-6-10)7-8-11;1-2/h3,8H,4-7H2,1-2H3;1H2 |
| InChIKey | LGLURUZRLQBOOB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;2-[1-(3-methylbut-2-enyl)cyclopropyl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;2-[1-(3-methylbut-2-enyl)cyclopropyl]acetaldehyde?
The IUPAC name of formaldehyde;2-[1-(3-methylbut-2-enyl)cyclopropyl]acetaldehyde (CID 87279246) is formaldehyde;2-[1-(3-methylbut-2-enyl)cyclopropyl]acetaldehyde.
What is the SMILES notation for formaldehyde;2-[1-(3-methylbut-2-enyl)cyclopropyl]acetaldehyde?
The canonical SMILES for formaldehyde;2-[1-(3-methylbut-2-enyl)cyclopropyl]acetaldehyde is C=O.CC(C)=CCC1(CC=O)CC1.
What is the InChIKey of formaldehyde;2-[1-(3-methylbut-2-enyl)cyclopropyl]acetaldehyde?
The InChIKey is LGLURUZRLQBOOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O.CH2O/c1-9(2)3-4-10(5-6-10)7-8-11;1-2/h3,8H,4-7H2,1-2H3;1H2.
What are the key properties of formaldehyde;2-[1-(3-methylbut-2-enyl)cyclopropyl]acetaldehyde?
formaldehyde;2-[1-(3-methylbut-2-enyl)cyclopropyl]acetaldehyde has a molecular weight of 182.26 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;2-[1-(3-methylbut-2-enyl)cyclopropyl]acetaldehyde is sourced from PubChem (CID 87279246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).