C33H35NO5 — CID 87279280
[(2S)-2-[3-formyl-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]ethyl] 2,2-dimethylpropanoate (PubChem CID 87279280) has the molecular formula C33H35NO5 and a molecular weight of 525.65 g/mol. Its IUPAC name is [(2S)-2-[3-formyl-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]ethyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S)-2-[3-formyl-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]ethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 87279280 |
| Molecular Formula | C33H35NO5 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | [(2S)-2-[3-formyl-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]ethyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)O[C@H](COC(=O)C(C)(C)C)c1c(C=O)cc2ccccc2c1-c1ccc2c3c(ccnc13)CCO2 |
| InChI | InChI=1S/C33H35NO5/c1-32(2,3)31(36)38-19-26(39-33(4,5)6)27-22(18-35)17-21-9-7-8-10-23(21)29(27)24-11-12-25-28-20(14-16-37-25)13-15-34-30(24)28/h7-13,15,17-18,26H,14,16,19H2,1-6H3/t26-/m1/s1 |
| InChIKey | ILEUMUCXPFLJQN-AREMUKBSSA-N |
| XLogP | 7.25 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|