About 4-(4-aminopyridin-1-ium-1-yl)-3-nitro-1-phenyl-1,8-naphthyridin-2-one chloride
4-(4-aminopyridin-1-ium-1-yl)-3-nitro-1-phenyl-1,8-naphthyridin-2-one chloride (PubChem CID 87279391) has the molecular formula C19H14ClN5O3
and a molecular weight of 395.81 g/mol. Its IUPAC name is 4-(4-aminopyridin-1-ium-1-yl)-3-nitro-1-phenyl-1,8-naphthyridin-2-one chloride.
Molecular Properties
| Compound Name | 4-(4-aminopyridin-1-ium-1-yl)-3-nitro-1-phenyl-1,8-naphthyridin-2-one chloride |
| PubChem CID | 87279391 |
| Molecular Formula | C19H14ClN5O3 |
| Molecular Weight | 395.81 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 4-(4-aminopyridin-1-ium-1-yl)-3-nitro-1-phenyl-1,8-naphthyridin-2-one chloride |
| SMILES | Nc1cc[n+](-c2c([N+](=O)[O-])c(=O)n(-c3ccccc3)c3ncccc23)cc1.[Cl-] |
| InChI | InChI=1S/C19H13N5O3.ClH/c20-13-8-11-22(12-9-13)16-15-7-4-10-21-18(15)23(14-5-2-1-3-6-14)19(25)17(16)24(26)27;/h1-12,20H;1H |
| InChIKey | GOHQLGAIGZQJGF-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.81 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminopyridin-1-ium-1-yl)-3-nitro-1-phenyl-1,8-naphthyridin-2-one chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminopyridin-1-ium-1-yl)-3-nitro-1-phenyl-1,8-naphthyridin-2-one chloride?
The IUPAC name of 4-(4-aminopyridin-1-ium-1-yl)-3-nitro-1-phenyl-1,8-naphthyridin-2-one chloride (CID 87279391) is 4-(4-aminopyridin-1-ium-1-yl)-3-nitro-1-phenyl-1,8-naphthyridin-2-one chloride.
What is the SMILES notation for 4-(4-aminopyridin-1-ium-1-yl)-3-nitro-1-phenyl-1,8-naphthyridin-2-one chloride?
The canonical SMILES for 4-(4-aminopyridin-1-ium-1-yl)-3-nitro-1-phenyl-1,8-naphthyridin-2-one chloride is Nc1cc[n+](-c2c([N+](=O)[O-])c(=O)n(-c3ccccc3)c3ncccc23)cc1.[Cl-].
What is the InChIKey of 4-(4-aminopyridin-1-ium-1-yl)-3-nitro-1-phenyl-1,8-naphthyridin-2-one chloride?
The InChIKey is GOHQLGAIGZQJGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13N5O3.ClH/c20-13-8-11-22(12-9-13)16-15-7-4-10-21-18(15)23(14-5-2-1-3-6-14)19(25)17(16)24(26)27;/h1-12,20H;1H.
What are the key properties of 4-(4-aminopyridin-1-ium-1-yl)-3-nitro-1-phenyl-1,8-naphthyridin-2-one chloride?
4-(4-aminopyridin-1-ium-1-yl)-3-nitro-1-phenyl-1,8-naphthyridin-2-one chloride has a molecular weight of 395.81 g/mol, XLogP of -0.84, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminopyridin-1-ium-1-yl)-3-nitro-1-phenyl-1,8-naphthyridin-2-one chloride is sourced from PubChem (CID 87279391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).