C22H44N4O12 — CID 87279542
(Z)-N',N'-bis[3-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]propyl]but-2-enediamide (PubChem CID 87279542) has the molecular formula C22H44N4O12 and a molecular weight of 556.61 g/mol. Its IUPAC name is (Z)-N',N'-bis[3-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]propyl]but-2-enediamide.
| Compound Name | (Z)-N',N'-bis[3-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]propyl]but-2-enediamide |
|---|---|
| PubChem CID | 87279542 |
| Molecular Formula | C22H44N4O12 |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | (Z)-N',N'-bis[3-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]propyl]but-2-enediamide |
| SMILES | NC(=O)/C=C\C(=O)N(CCCNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)CCCNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C22H44N4O12/c23-17(33)3-4-18(34)26(7-1-5-24-9-13(29)19(35)21(37)15(31)11-27)8-2-6-25-10-14(30)20(36)22(38)16(32)12-28/h3-4,13-16,19-22,24-25,27-32,35-38H,1-2,5-12H2,(H2,23,33)/b4-3-/t13-,14-,15+,16+,19+,20+,21+,22+/m0/s1 |
| InChIKey | KLARGDXHOWCMAW-QZEDCCERSA-N |
| XLogP | -7.31 |
| TPSA | 289.76 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | -7.31 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|