C12H23N3O7 — CID 87279579
(Z)-N'-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethyl]but-2-enediamide (PubChem CID 87279579) has the molecular formula C12H23N3O7 and a molecular weight of 321.33 g/mol. Its IUPAC name is (Z)-N'-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethyl]but-2-enediamide.
| Compound Name | (Z)-N'-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethyl]but-2-enediamide |
|---|---|
| PubChem CID | 87279579 |
| Molecular Formula | C12H23N3O7 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (Z)-N'-[2-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]ethyl]but-2-enediamide |
| SMILES | NC(=O)/C=C\C(=O)NCCNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H23N3O7/c13-9(19)1-2-10(20)15-4-3-14-5-7(17)11(21)12(22)8(18)6-16/h1-2,7-8,11-12,14,16-18,21-22H,3-6H2,(H2,13,19)(H,15,20)/b2-1-/t7-,8+,11+,12+/m0/s1 |
| InChIKey | CUAZHSRVLFXKIA-MKMGXSLBSA-N |
| XLogP | -4.83 |
| TPSA | 185.37 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | -4.83 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|