C22H19F2N3O2 — CID 87279604
N-(2,6-difluorophenyl)-N-[5-(3,3,6-trimethyl-2H-1-benzofuran-5-yl)pyrazin-2-yl]formamide (PubChem CID 87279604) has the molecular formula C22H19F2N3O2 and a molecular weight of 395.41 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-N-[5-(3,3,6-trimethyl-2H-1-benzofuran-5-yl)pyrazin-2-yl]formamide.
| Compound Name | N-(2,6-difluorophenyl)-N-[5-(3,3,6-trimethyl-2H-1-benzofuran-5-yl)pyrazin-2-yl]formamide |
|---|---|
| PubChem CID | 87279604 |
| Molecular Formula | C22H19F2N3O2 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-(2,6-difluorophenyl)-N-[5-(3,3,6-trimethyl-2H-1-benzofuran-5-yl)pyrazin-2-yl]formamide |
| SMILES | Cc1cc2c(cc1-c1cnc(N(C=O)c3c(F)cccc3F)cn1)C(C)(C)CO2 |
| InChI | InChI=1S/C22H19F2N3O2/c1-13-7-19-15(22(2,3)11-29-19)8-14(13)18-9-26-20(10-25-18)27(12-28)21-16(23)5-4-6-17(21)24/h4-10,12H,11H2,1-3H3 |
| InChIKey | NENOUSPBRMKJKG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|