About 1-chloro-3-fluoro-2-methoxybenzene-4-ide;zinc;hydrochloride
1-chloro-3-fluoro-2-methoxybenzene-4-ide;zinc;hydrochloride (PubChem CID 87280067) has the molecular formula C7H6Cl2FOZn-
and a molecular weight of 261.42 g/mol. Its IUPAC name is 1-chloro-3-fluoro-2-methoxybenzene-4-ide;zinc;hydrochloride.
Molecular Properties
| Compound Name | 1-chloro-3-fluoro-2-methoxybenzene-4-ide;zinc;hydrochloride |
| PubChem CID | 87280067 |
| Molecular Formula | C7H6Cl2FOZn- |
| Molecular Weight | 261.42 g/mol |
| Exact Mass | 258.91 |
| IUPAC Name | 1-chloro-3-fluoro-2-methoxybenzene-4-ide;zinc;hydrochloride |
| SMILES | COc1c(F)[c-]ccc1Cl.Cl.[Zn] |
| InChI | InChI=1S/C7H5ClFO.ClH.Zn/c1-10-7-5(8)3-2-4-6(7)9;;/h2-3H,1H3;1H;/q-1;; |
| InChIKey | NAFDIPISLHPYGU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-fluoro-2-methoxybenzene-4-ide;zinc;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-fluoro-2-methoxybenzene-4-ide;zinc;hydrochloride?
The IUPAC name of 1-chloro-3-fluoro-2-methoxybenzene-4-ide;zinc;hydrochloride (CID 87280067) is 1-chloro-3-fluoro-2-methoxybenzene-4-ide;zinc;hydrochloride.
What is the SMILES notation for 1-chloro-3-fluoro-2-methoxybenzene-4-ide;zinc;hydrochloride?
The canonical SMILES for 1-chloro-3-fluoro-2-methoxybenzene-4-ide;zinc;hydrochloride is COc1c(F)[c-]ccc1Cl.Cl.[Zn].
What is the InChIKey of 1-chloro-3-fluoro-2-methoxybenzene-4-ide;zinc;hydrochloride?
The InChIKey is NAFDIPISLHPYGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClFO.ClH.Zn/c1-10-7-5(8)3-2-4-6(7)9;;/h2-3H,1H3;1H;/q-1;;.
What are the key properties of 1-chloro-3-fluoro-2-methoxybenzene-4-ide;zinc;hydrochloride?
1-chloro-3-fluoro-2-methoxybenzene-4-ide;zinc;hydrochloride has a molecular weight of 261.42 g/mol, XLogP of 2.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-fluoro-2-methoxybenzene-4-ide;zinc;hydrochloride is sourced from PubChem (CID 87280067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).