About 2-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]-2-sulfanylacetamide
2-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]-2-sulfanylacetamide (PubChem CID 87280459) has the molecular formula C10H13NO4S
and a molecular weight of 243.28 g/mol. Its IUPAC name is 2-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]-2-sulfanylacetamide.
Molecular Properties
| Compound Name | 2-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]-2-sulfanylacetamide |
| PubChem CID | 87280459 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]-2-sulfanylacetamide |
| SMILES | CC1(c2ccc(C(S)C(N)=O)o2)OCCO1 |
| InChI | InChI=1S/C10H13NO4S/c1-10(13-4-5-14-10)7-3-2-6(15-7)8(16)9(11)12/h2-3,8,16H,4-5H2,1H3,(H2,11,12) |
| InChIKey | VZOXRMOPAUJRTJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]-2-sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]-2-sulfanylacetamide?
The IUPAC name of 2-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]-2-sulfanylacetamide (CID 87280459) is 2-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]-2-sulfanylacetamide.
What is the SMILES notation for 2-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]-2-sulfanylacetamide?
The canonical SMILES for 2-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]-2-sulfanylacetamide is CC1(c2ccc(C(S)C(N)=O)o2)OCCO1.
What is the InChIKey of 2-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]-2-sulfanylacetamide?
The InChIKey is VZOXRMOPAUJRTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4S/c1-10(13-4-5-14-10)7-3-2-6(15-7)8(16)9(11)12/h2-3,8,16H,4-5H2,1H3,(H2,11,12).
What are the key properties of 2-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]-2-sulfanylacetamide?
2-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]-2-sulfanylacetamide has a molecular weight of 243.28 g/mol, XLogP of 0.96, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]-2-sulfanylacetamide is sourced from PubChem (CID 87280459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).