About allyl-selenocysteine
allyl-selenocysteine (PubChem CID 87280558) has the molecular formula C6H10NO2Se
and a molecular weight of 207.11 g/mol.
Molecular Properties
| Compound Name | allyl-selenocysteine |
| PubChem CID | 87280558 |
| Molecular Formula | C6H10NO2Se |
| Molecular Weight | 207.11 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | — |
| SMILES | C=CCN[C@@H](C[Se])C(=O)O |
| InChI | InChI=1S/C6H10NO2Se/c1-2-3-7-5(4-10)6(8)9/h2,5,7H,1,3-4H2,(H,8,9)/t5-/m0/s1 |
| InChIKey | LZLPRBCGHLAHBQ-YFKPBYRVSA-N |
| XLogP | -0.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.11 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze allyl-selenocysteine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of allyl-selenocysteine?
The IUPAC name of allyl-selenocysteine (CID 87280558) is not available.
What is the SMILES notation for allyl-selenocysteine?
The canonical SMILES for allyl-selenocysteine is C=CCN[C@@H](C[Se])C(=O)O.
What is the InChIKey of allyl-selenocysteine?
The InChIKey is LZLPRBCGHLAHBQ-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H10NO2Se/c1-2-3-7-5(4-10)6(8)9/h2,5,7H,1,3-4H2,(H,8,9)/t5-/m0/s1.
What are the key properties of allyl-selenocysteine?
allyl-selenocysteine has a molecular weight of 207.11 g/mol, XLogP of -0.20, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for allyl-selenocysteine is sourced from PubChem (CID 87280558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).