C9H19NO4 — CID 87280956
N-[(3R,5S)-3,5,6-trihydroxyhexyl]propanamide (PubChem CID 87280956) has the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. Its IUPAC name is N-[(3R,5S)-3,5,6-trihydroxyhexyl]propanamide.
| Compound Name | N-[(3R,5S)-3,5,6-trihydroxyhexyl]propanamide |
|---|---|
| PubChem CID | 87280956 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N-[(3R,5S)-3,5,6-trihydroxyhexyl]propanamide |
| SMILES | CCC(=O)NCC[C@@H](O)C[C@H](O)CO |
| InChI | InChI=1S/C9H19NO4/c1-2-9(14)10-4-3-7(12)5-8(13)6-11/h7-8,11-13H,2-6H2,1H3,(H,10,14)/t7-,8+/m1/s1 |
| InChIKey | VLWBOIRKPMMMDZ-SFYZADRCSA-N |
| XLogP | -0.99 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |