About N,3,5-trimethylhex-5-enamide
N,3,5-trimethylhex-5-enamide (PubChem CID 87280957) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is N,3,5-trimethylhex-5-enamide.
Molecular Properties
| Compound Name | N,3,5-trimethylhex-5-enamide |
| PubChem CID | 87280957 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | N,3,5-trimethylhex-5-enamide |
| SMILES | C=C(C)CC(C)CC(=O)NC |
| InChI | InChI=1S/C9H17NO/c1-7(2)5-8(3)6-9(11)10-4/h8H,1,5-6H2,2-4H3,(H,10,11) |
| InChIKey | ALFVBMYAFJFWSS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,3,5-trimethylhex-5-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3,5-trimethylhex-5-enamide?
The IUPAC name of N,3,5-trimethylhex-5-enamide (CID 87280957) is N,3,5-trimethylhex-5-enamide.
What is the SMILES notation for N,3,5-trimethylhex-5-enamide?
The canonical SMILES for N,3,5-trimethylhex-5-enamide is C=C(C)CC(C)CC(=O)NC.
What is the InChIKey of N,3,5-trimethylhex-5-enamide?
The InChIKey is ALFVBMYAFJFWSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c1-7(2)5-8(3)6-9(11)10-4/h8H,1,5-6H2,2-4H3,(H,10,11).
What are the key properties of N,3,5-trimethylhex-5-enamide?
N,3,5-trimethylhex-5-enamide has a molecular weight of 155.24 g/mol, XLogP of 1.72, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,3,5-trimethylhex-5-enamide is sourced from PubChem (CID 87280957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).