C47H48F4N2O4 — CID 87281126
[(Z)-[[11-(2-ethylhexyl)-5-(2,3,5,6-tetramethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate (PubChem CID 87281126) has the molecular formula C47H48F4N2O4 and a molecular weight of 780.90 g/mol. Its IUPAC name is [(Z)-[[11-(2-ethylhexyl)-5-(2,3,5,6-tetramethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate.
| Compound Name | [(Z)-[[11-(2-ethylhexyl)-5-(2,3,5,6-tetramethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 87281126 |
| Molecular Formula | C47H48F4N2O4 |
| Molecular Weight | 780.90 g/mol |
| Exact Mass | 780.36 |
| IUPAC Name | [(Z)-[[11-(2-ethylhexyl)-5-(2,3,5,6-tetramethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate |
| SMILES | CCCCC(CC)Cn1c2ccc(/C(=N/OC(C)=O)c3ccccc3OCC(F)(F)C(F)F)cc2c2cc(C(=O)c3c(C)c(C)cc(C)c3C)c3ccccc3c21 |
| InChI | InChI=1S/C47H48F4N2O4/c1-8-10-15-32(9-2)25-53-40-21-20-33(43(52-57-31(7)54)36-18-13-14-19-41(36)56-26-47(50,51)46(48)49)23-37(40)38-24-39(34-16-11-12-17-35(34)44(38)53)45(55)42-29(5)27(3)22-28(4)30(42)6/h11-14,16-24,32,46H,8-10,15,25-26H2,1-7H3/b52-43- |
| InChIKey | RPVHUEUJHZOKDJ-QYQOIUEJSA-N |
| XLogP | 12.22 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.90 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|