C34H29F4NO3 — CID 87281131
11-(cyclohexylmethyl)-8-[2-(2,2,3,3-tetrafluoropropoxy)benzoyl]benzo[a]carbazole-5-carbaldehyde (PubChem CID 87281131) has the molecular formula C34H29F4NO3 and a molecular weight of 575.60 g/mol. Its IUPAC name is 11-(cyclohexylmethyl)-8-[2-(2,2,3,3-tetrafluoropropoxy)benzoyl]benzo[a]carbazole-5-carbaldehyde.
| Compound Name | 11-(cyclohexylmethyl)-8-[2-(2,2,3,3-tetrafluoropropoxy)benzoyl]benzo[a]carbazole-5-carbaldehyde |
|---|---|
| PubChem CID | 87281131 |
| Molecular Formula | C34H29F4NO3 |
| Molecular Weight | 575.60 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 11-(cyclohexylmethyl)-8-[2-(2,2,3,3-tetrafluoropropoxy)benzoyl]benzo[a]carbazole-5-carbaldehyde |
| SMILES | O=Cc1cc2c3cc(C(=O)c4ccccc4OCC(F)(F)C(F)F)ccc3n(CC3CCCCC3)c2c2ccccc12 |
| InChI | InChI=1S/C34H29F4NO3/c35-33(36)34(37,38)20-42-30-13-7-6-12-26(30)32(41)22-14-15-29-27(16-22)28-17-23(19-40)24-10-4-5-11-25(24)31(28)39(29)18-21-8-2-1-3-9-21/h4-7,10-17,19,21,33H,1-3,8-9,18,20H2 |
| InChIKey | VZXJRDVNYWGIQS-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.60 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|