C43H38F4N2O5 — CID 87281140
[(E)-[[11-(oxolan-2-ylmethyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate (PubChem CID 87281140) has the molecular formula C43H38F4N2O5 and a molecular weight of 738.78 g/mol. Its IUPAC name is [(E)-[[11-(oxolan-2-ylmethyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate.
| Compound Name | [(E)-[[11-(oxolan-2-ylmethyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 87281140 |
| Molecular Formula | C43H38F4N2O5 |
| Molecular Weight | 738.78 g/mol |
| Exact Mass | 738.27 |
| IUPAC Name | [(E)-[[11-(oxolan-2-ylmethyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\c1ccc2c(c1)c1cc(C(=O)c3c(C)cc(C)cc3C)c3ccccc3c1n2CC1CCCO1)c1ccccc1OCC(F)(F)C(F)F |
| InChI | InChI=1S/C43H38F4N2O5/c1-24-18-25(2)38(26(3)19-24)41(51)35-21-34-33-20-28(39(48-54-27(4)50)32-13-7-8-14-37(32)53-23-43(46,47)42(44)45)15-16-36(33)49(22-29-10-9-17-52-29)40(34)31-12-6-5-11-30(31)35/h5-8,11-16,18-21,29,42H,9-10,17,22-23H2,1-4H3/b48-39+ |
| InChIKey | XROHVPJMAOLIGW-ZOJZNMBWSA-N |
| XLogP | 9.88 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.78 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|