C44H44F4N2O3 — CID 87281149
[11-(2-ethylhexyl)-5-[(E)-N-hydroxy-C-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]carbonimidoyl]benzo[a]carbazol-8-yl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 87281149) has the molecular formula C44H44F4N2O3 and a molecular weight of 724.84 g/mol. Its IUPAC name is [11-(2-ethylhexyl)-5-[(E)-N-hydroxy-C-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]carbonimidoyl]benzo[a]carbazol-8-yl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [11-(2-ethylhexyl)-5-[(E)-N-hydroxy-C-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]carbonimidoyl]benzo[a]carbazol-8-yl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 87281149 |
| Molecular Formula | C44H44F4N2O3 |
| Molecular Weight | 724.84 g/mol |
| Exact Mass | 724.33 |
| IUPAC Name | [11-(2-ethylhexyl)-5-[(E)-N-hydroxy-C-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]carbonimidoyl]benzo[a]carbazol-8-yl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | CCCCC(CC)Cn1c2ccc(C(=O)c3c(C)cc(C)cc3C)cc2c2cc(/C(=N/O)c3ccc(OCC(F)(F)C(F)F)cc3)c3ccccc3c21 |
| InChI | InChI=1S/C44H44F4N2O3/c1-6-8-11-29(7-2)24-50-38-19-16-31(42(51)39-27(4)20-26(3)21-28(39)5)22-35(38)37-23-36(33-12-9-10-13-34(33)41(37)50)40(49-52)30-14-17-32(18-15-30)53-25-44(47,48)43(45)46/h9-10,12-23,29,43,52H,6-8,11,24-25H2,1-5H3/b49-40+ |
| InChIKey | DNTRGLFRQQZTCJ-URKJGAIASA-N |
| XLogP | 11.83 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.84 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|