C50H42F4N4O3 — CID 87281150
[(E)-[[11-(cyclohexylmethyl)-5-(4,5-diphenyl-1H-imidazol-2-yl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate (PubChem CID 87281150) has the molecular formula C50H42F4N4O3 and a molecular weight of 822.90 g/mol. Its IUPAC name is [(E)-[[11-(cyclohexylmethyl)-5-(4,5-diphenyl-1H-imidazol-2-yl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate.
| Compound Name | [(E)-[[11-(cyclohexylmethyl)-5-(4,5-diphenyl-1H-imidazol-2-yl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 87281150 |
| Molecular Formula | C50H42F4N4O3 |
| Molecular Weight | 822.90 g/mol |
| Exact Mass | 822.32 |
| IUPAC Name | [(E)-[[11-(cyclohexylmethyl)-5-(4,5-diphenyl-1H-imidazol-2-yl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\c1ccc2c(c1)c1cc(-c3nc(-c4ccccc4)c(-c4ccccc4)[nH]3)c3ccccc3c1n2CC1CCCCC1)c1ccccc1OCC(F)(F)C(F)F |
| InChI | InChI=1S/C50H42F4N4O3/c1-31(59)61-57-44(38-23-13-14-24-43(38)60-30-50(53,54)49(51)52)35-25-26-42-39(27-35)40-28-41(36-21-11-12-22-37(36)47(40)58(42)29-32-15-5-2-6-16-32)48-55-45(33-17-7-3-8-18-33)46(56-48)34-19-9-4-10-20-34/h3-4,7-14,17-28,32,49H,2,5-6,15-16,29-30H2,1H3,(H,55,56)/b57-44+ |
| InChIKey | RSUNYKZTOOEZKJ-CCHJLRPZSA-N |
| XLogP | 12.85 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.90 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|