C16H21NOS — CID 87281232
3-hydroxy-3-[3-[(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)methylsulfanyl]phenyl]propanenitrile (PubChem CID 87281232) has the molecular formula C16H21NOS and a molecular weight of 286.48 g/mol. Its IUPAC name is 3-hydroxy-3-[3-[(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)methylsulfanyl]phenyl]propanenitrile.
| Compound Name | 3-hydroxy-3-[3-[(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)methylsulfanyl]phenyl]propanenitrile |
|---|---|
| PubChem CID | 87281232 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 286.48 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 3-hydroxy-3-[3-[(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)methylsulfanyl]phenyl]propanenitrile |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])([2H])C([2H])(CSc2cccc(C(O)CC#N)c2)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C16H21NOS/c17-10-9-16(18)14-7-4-8-15(11-14)19-12-13-5-2-1-3-6-13/h4,7-8,11,13,16,18H,1-3,5-6,9,12H2/i1D2,2D2,3D2,5D2,6D2,13D |
| InChIKey | HVBDBIRRNPCQHD-NMVSHNHUSA-N |
| XLogP | 4.31 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |