About (4-amino-4-oxobutyl) 4-(2,4-difluorophenyl)benzenesulfonate
(4-amino-4-oxobutyl) 4-(2,4-difluorophenyl)benzenesulfonate (PubChem CID 87281370) has the molecular formula C16H15F2NO4S
and a molecular weight of 355.36 g/mol. Its IUPAC name is (4-amino-4-oxobutyl) 4-(2,4-difluorophenyl)benzenesulfonate.
Molecular Properties
| Compound Name | (4-amino-4-oxobutyl) 4-(2,4-difluorophenyl)benzenesulfonate |
| PubChem CID | 87281370 |
| Molecular Formula | C16H15F2NO4S |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | (4-amino-4-oxobutyl) 4-(2,4-difluorophenyl)benzenesulfonate |
| SMILES | NC(=O)CCCOS(=O)(=O)c1ccc(-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C16H15F2NO4S/c17-12-5-8-14(15(18)10-12)11-3-6-13(7-4-11)24(21,22)23-9-1-2-16(19)20/h3-8,10H,1-2,9H2,(H2,19,20) |
| InChIKey | QTFUXMKQYPBTJA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-4-oxobutyl) 4-(2,4-difluorophenyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-4-oxobutyl) 4-(2,4-difluorophenyl)benzenesulfonate?
The IUPAC name of (4-amino-4-oxobutyl) 4-(2,4-difluorophenyl)benzenesulfonate (CID 87281370) is (4-amino-4-oxobutyl) 4-(2,4-difluorophenyl)benzenesulfonate.
What is the SMILES notation for (4-amino-4-oxobutyl) 4-(2,4-difluorophenyl)benzenesulfonate?
The canonical SMILES for (4-amino-4-oxobutyl) 4-(2,4-difluorophenyl)benzenesulfonate is NC(=O)CCCOS(=O)(=O)c1ccc(-c2ccc(F)cc2F)cc1.
What is the InChIKey of (4-amino-4-oxobutyl) 4-(2,4-difluorophenyl)benzenesulfonate?
The InChIKey is QTFUXMKQYPBTJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F2NO4S/c17-12-5-8-14(15(18)10-12)11-3-6-13(7-4-11)24(21,22)23-9-1-2-16(19)20/h3-8,10H,1-2,9H2,(H2,19,20).
What are the key properties of (4-amino-4-oxobutyl) 4-(2,4-difluorophenyl)benzenesulfonate?
(4-amino-4-oxobutyl) 4-(2,4-difluorophenyl)benzenesulfonate has a molecular weight of 355.36 g/mol, XLogP of 2.60, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-4-oxobutyl) 4-(2,4-difluorophenyl)benzenesulfonate is sourced from PubChem (CID 87281370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).