C18H28N2O5 — CID 87281846
5-[6-methyl-1,9-bis(oxiran-2-yl)nonan-4-yl]-1,3-diazinane-2,4,6-trione (PubChem CID 87281846) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is 5-[6-methyl-1,9-bis(oxiran-2-yl)nonan-4-yl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[6-methyl-1,9-bis(oxiran-2-yl)nonan-4-yl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 87281846 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 5-[6-methyl-1,9-bis(oxiran-2-yl)nonan-4-yl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC(CCCC1CO1)CC(CCCC1CO1)C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C18H28N2O5/c1-11(4-2-6-13-9-24-13)8-12(5-3-7-14-10-25-14)15-16(21)19-18(23)20-17(15)22/h11-15H,2-10H2,1H3,(H2,19,20,21,22,23) |
| InChIKey | KIGZWPQNVUEXQZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 100.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|