C29H27N3O2 — CID 87282294
1-oxo-2-phenyl-N-[(1S)-1-phenylpropyl]-3-[(prop-2-ynylamino)methyl]isoquinoline-4-carboxamide (PubChem CID 87282294) has the molecular formula C29H27N3O2 and a molecular weight of 449.55 g/mol. Its IUPAC name is 1-oxo-2-phenyl-N-[(1S)-1-phenylpropyl]-3-[(prop-2-ynylamino)methyl]isoquinoline-4-carboxamide.
| Compound Name | 1-oxo-2-phenyl-N-[(1S)-1-phenylpropyl]-3-[(prop-2-ynylamino)methyl]isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 87282294 |
| Molecular Formula | C29H27N3O2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 1-oxo-2-phenyl-N-[(1S)-1-phenylpropyl]-3-[(prop-2-ynylamino)methyl]isoquinoline-4-carboxamide |
| SMILES | C#CCNCc1c(C(=O)N[C@@H](CC)c2ccccc2)c2ccccc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C29H27N3O2/c1-3-19-30-20-26-27(28(33)31-25(4-2)21-13-7-5-8-14-21)23-17-11-12-18-24(23)29(34)32(26)22-15-9-6-10-16-22/h1,5-18,25,30H,4,19-20H2,2H3,(H,31,33)/t25-/m0/s1 |
| InChIKey | RQHDWMZEMADFNJ-VWLOTQADSA-N |
| XLogP | 4.59 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|