C21H13BrF4N4O2 — CID 87282324
[(4-fluorophenyl)methylamino] 3-bromo-5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 87282324) has the molecular formula C21H13BrF4N4O2 and a molecular weight of 509.26 g/mol. Its IUPAC name is [(4-fluorophenyl)methylamino] 3-bromo-5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | [(4-fluorophenyl)methylamino] 3-bromo-5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 87282324 |
| Molecular Formula | C21H13BrF4N4O2 |
| Molecular Weight | 509.26 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | [(4-fluorophenyl)methylamino] 3-bromo-5-phenyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | O=C(ONCc1ccc(F)cc1)c1nn2c(C(F)(F)F)cc(-c3ccccc3)nc2c1Br |
| InChI | InChI=1S/C21H13BrF4N4O2/c22-17-18(20(31)32-27-11-12-6-8-14(23)9-7-12)29-30-16(21(24,25)26)10-15(28-19(17)30)13-4-2-1-3-5-13/h1-10,27H,11H2 |
| InChIKey | KPZQHPKLJLFICM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.26 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|