C8H12F6O3 — CID 87282326
1,1,1-trifluoro-2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethane (PubChem CID 87282326) has the molecular formula C8H12F6O3 and a molecular weight of 270.17 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethane.
| Compound Name | 1,1,1-trifluoro-2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethane |
|---|---|
| PubChem CID | 87282326 |
| Molecular Formula | C8H12F6O3 |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1,1,1-trifluoro-2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethane |
| SMILES | FC(F)(F)COCCOCCOCC(F)(F)F |
| InChI | InChI=1S/C8H12F6O3/c9-7(10,11)5-16-3-1-15-2-4-17-6-8(12,13)14/h1-6H2 |
| InChIKey | UHIKTEOLOIVDKF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|