About 6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid
6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 87282734) has the molecular formula C7H6O4S
and a molecular weight of 186.19 g/mol. Its IUPAC name is 6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 87282734 |
| Molecular Formula | C7H6O4S |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | 6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C1C=CC=CC1=S(=O)=O |
| InChI | InChI=1S/C7H6O4S/c8-7(9)5-3-1-2-4-6(5)12(10)11/h1-5H,(H,8,9) |
| InChIKey | USSHTWOXWQEPPI-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid (CID 87282734) is 6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid is O=C(O)C1C=CC=CC1=S(=O)=O.
What is the InChIKey of 6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is USSHTWOXWQEPPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O4S/c8-7(9)5-3-1-2-4-6(5)12(10)11/h1-5H,(H,8,9).
What are the key properties of 6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid?
6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 186.19 g/mol, XLogP of -0.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 87282734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).