About 2-aminoguanidine;bis(guanidine)
2-aminoguanidine;bis(guanidine) (PubChem CID 87282941) has the molecular formula C3H16N10
and a molecular weight of 192.23 g/mol. Its IUPAC name is 2-aminoguanidine;bis(guanidine).
Molecular Properties
| Compound Name | 2-aminoguanidine;bis(guanidine) |
| PubChem CID | 87282941 |
| Molecular Formula | C3H16N10 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-aminoguanidine;bis(guanidine) |
| SMILES | NN=C(N)N.[H]N=C(N)N.[H]N=C(N)N |
| InChI | InChI=1S/CH6N4.2CH5N3/c2-1(3)5-4;2*2-1(3)4/h4H2,(H4,2,3,5);2*(H5,2,3,4) |
| InChIKey | UGJFYACURFBKAJ-UHFFFAOYSA-N |
| XLogP | -4.19 |
| TPSA | 242.20 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoguanidine;bis(guanidine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoguanidine;bis(guanidine)?
The IUPAC name of 2-aminoguanidine;bis(guanidine) (CID 87282941) is 2-aminoguanidine;bis(guanidine).
What is the SMILES notation for 2-aminoguanidine;bis(guanidine)?
The canonical SMILES for 2-aminoguanidine;bis(guanidine) is NN=C(N)N.[H]N=C(N)N.[H]N=C(N)N.
What is the InChIKey of 2-aminoguanidine;bis(guanidine)?
The InChIKey is UGJFYACURFBKAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/CH6N4.2CH5N3/c2-1(3)5-4;2*2-1(3)4/h4H2,(H4,2,3,5);2*(H5,2,3,4).
What are the key properties of 2-aminoguanidine;bis(guanidine)?
2-aminoguanidine;bis(guanidine) has a molecular weight of 192.23 g/mol, XLogP of -4.19, 0 rotatable bonds, 9 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoguanidine;bis(guanidine) is sourced from PubChem (CID 87282941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).