C21H26F3N3O7S — CID 87282960
tert-butyl 3-(5-carbamoylpyrrolidine-2-carbonyl)-7-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 87282960) has the molecular formula C21H26F3N3O7S and a molecular weight of 521.51 g/mol. Its IUPAC name is tert-butyl 3-(5-carbamoylpyrrolidine-2-carbonyl)-7-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 3-(5-carbamoylpyrrolidine-2-carbonyl)-7-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 87282960 |
| Molecular Formula | C21H26F3N3O7S |
| Molecular Weight | 521.51 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | tert-butyl 3-(5-carbamoylpyrrolidine-2-carbonyl)-7-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2cc(OS(=O)(=O)C(F)(F)F)ccc2CC1C(=O)C1CCC(C(N)=O)N1 |
| InChI | InChI=1S/C21H26F3N3O7S/c1-20(2,3)33-19(30)27-10-12-8-13(34-35(31,32)21(22,23)24)5-4-11(12)9-16(27)17(28)14-6-7-15(26-14)18(25)29/h4-5,8,14-16,26H,6-7,9-10H2,1-3H3,(H2,25,29) |
| InChIKey | ZNKBEXOWNCTWHL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.51 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|