C21H24F3N3O6S — CID 87282965
tert-butyl 3-(5-cyanopyrrolidine-2-carbonyl)-7-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 87282965) has the molecular formula C21H24F3N3O6S and a molecular weight of 503.50 g/mol. Its IUPAC name is tert-butyl 3-(5-cyanopyrrolidine-2-carbonyl)-7-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 3-(5-cyanopyrrolidine-2-carbonyl)-7-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 87282965 |
| Molecular Formula | C21H24F3N3O6S |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | tert-butyl 3-(5-cyanopyrrolidine-2-carbonyl)-7-(trifluoromethylsulfonyloxy)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2cc(OS(=O)(=O)C(F)(F)F)ccc2CC1C(=O)C1CCC(C#N)N1 |
| InChI | InChI=1S/C21H24F3N3O6S/c1-20(2,3)32-19(29)27-11-13-8-15(33-34(30,31)21(22,23)24)6-4-12(13)9-17(27)18(28)16-7-5-14(10-25)26-16/h4,6,8,14,16-17,26H,5,7,9,11H2,1-3H3 |
| InChIKey | IOMYRBZPMAFGNR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|