About 2-octa-1,7-dien-4-yloxyethanamine
2-octa-1,7-dien-4-yloxyethanamine (PubChem CID 87283410) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 2-octa-1,7-dien-4-yloxyethanamine.
Molecular Properties
| Compound Name | 2-octa-1,7-dien-4-yloxyethanamine |
| PubChem CID | 87283410 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 2-octa-1,7-dien-4-yloxyethanamine |
| SMILES | C=CCCC(CC=C)OCCN |
| InChI | InChI=1S/C10H19NO/c1-3-5-7-10(6-4-2)12-9-8-11/h3-4,10H,1-2,5-9,11H2 |
| InChIKey | RPAISZVOQXZNSF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-octa-1,7-dien-4-yloxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octa-1,7-dien-4-yloxyethanamine?
The IUPAC name of 2-octa-1,7-dien-4-yloxyethanamine (CID 87283410) is 2-octa-1,7-dien-4-yloxyethanamine.
What is the SMILES notation for 2-octa-1,7-dien-4-yloxyethanamine?
The canonical SMILES for 2-octa-1,7-dien-4-yloxyethanamine is C=CCCC(CC=C)OCCN.
What is the InChIKey of 2-octa-1,7-dien-4-yloxyethanamine?
The InChIKey is RPAISZVOQXZNSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO/c1-3-5-7-10(6-4-2)12-9-8-11/h3-4,10H,1-2,5-9,11H2.
What are the key properties of 2-octa-1,7-dien-4-yloxyethanamine?
2-octa-1,7-dien-4-yloxyethanamine has a molecular weight of 169.27 g/mol, XLogP of 1.87, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octa-1,7-dien-4-yloxyethanamine is sourced from PubChem (CID 87283410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).