2,4,4-trimethylpentan-2-ylsulfamic acid

C8H19NO3S — CID 87283427

IUPAC2,4,4-trimethylpentan-2-ylsulfamic acid
SMILESCC(C)(C)CC(C)(C)NS(=O)(=O)O
InChIInChI=1S/C8H19NO3S/c1-7(2,3)6-8(4,5)9-13(10,11)12/h9H,6H2,1-5H3,(H,10,11,12)
InChIKeyAXTILJUDSBWVLS-UHFFFAOYSA-N
MW209.31 g/mol
LogP1.59
Rot. Bonds3

About 2,4,4-trimethylpentan-2-ylsulfamic acid

2,4,4-trimethylpentan-2-ylsulfamic acid (PubChem CID 87283427) has the molecular formula C8H19NO3S and a molecular weight of 209.31 g/mol. Its IUPAC name is 2,4,4-trimethylpentan-2-ylsulfamic acid.

Molecular Properties

Compound Name2,4,4-trimethylpentan-2-ylsulfamic acid
PubChem CID87283427
Molecular FormulaC8H19NO3S
Molecular Weight209.31 g/mol
Exact Mass209.11
IUPAC Name2,4,4-trimethylpentan-2-ylsulfamic acid
SMILESCC(C)(C)CC(C)(C)NS(=O)(=O)O
InChIInChI=1S/C8H19NO3S/c1-7(2,3)6-8(4,5)9-13(10,11)12/h9H,6H2,1-5H3,(H,10,11,12)
InChIKeyAXTILJUDSBWVLS-UHFFFAOYSA-N
XLogP1.59
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.31
LogP ≤ 51.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2,4,4-trimethylpentan-2-ylsulfamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4,4-trimethylpentan-2-ylsulfamic acid?
The IUPAC name of 2,4,4-trimethylpentan-2-ylsulfamic acid (CID 87283427) is 2,4,4-trimethylpentan-2-ylsulfamic acid.
What is the SMILES notation for 2,4,4-trimethylpentan-2-ylsulfamic acid?
The canonical SMILES for 2,4,4-trimethylpentan-2-ylsulfamic acid is CC(C)(C)CC(C)(C)NS(=O)(=O)O.
What is the InChIKey of 2,4,4-trimethylpentan-2-ylsulfamic acid?
The InChIKey is AXTILJUDSBWVLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO3S/c1-7(2,3)6-8(4,5)9-13(10,11)12/h9H,6H2,1-5H3,(H,10,11,12).
What are the key properties of 2,4,4-trimethylpentan-2-ylsulfamic acid?
2,4,4-trimethylpentan-2-ylsulfamic acid has a molecular weight of 209.31 g/mol, XLogP of 1.59, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,4-trimethylpentan-2-ylsulfamic acid is sourced from PubChem (CID 87283427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).