About 7,7-dimethyloctylsulfamic acid
7,7-dimethyloctylsulfamic acid (PubChem CID 87283491) has the molecular formula C10H23NO3S
and a molecular weight of 237.36 g/mol. Its IUPAC name is 7,7-dimethyloctylsulfamic acid.
Molecular Properties
| Compound Name | 7,7-dimethyloctylsulfamic acid |
| PubChem CID | 87283491 |
| Molecular Formula | C10H23NO3S |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 7,7-dimethyloctylsulfamic acid |
| SMILES | CC(C)(C)CCCCCCNS(=O)(=O)O |
| InChI | InChI=1S/C10H23NO3S/c1-10(2,3)8-6-4-5-7-9-11-15(12,13)14/h11H,4-9H2,1-3H3,(H,12,13,14) |
| InChIKey | IEUNTDYCKKBXND-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 7,7-dimethyloctylsulfamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyloctylsulfamic acid?
The IUPAC name of 7,7-dimethyloctylsulfamic acid (CID 87283491) is 7,7-dimethyloctylsulfamic acid.
What is the SMILES notation for 7,7-dimethyloctylsulfamic acid?
The canonical SMILES for 7,7-dimethyloctylsulfamic acid is CC(C)(C)CCCCCCNS(=O)(=O)O.
What is the InChIKey of 7,7-dimethyloctylsulfamic acid?
The InChIKey is IEUNTDYCKKBXND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO3S/c1-10(2,3)8-6-4-5-7-9-11-15(12,13)14/h11H,4-9H2,1-3H3,(H,12,13,14).
What are the key properties of 7,7-dimethyloctylsulfamic acid?
7,7-dimethyloctylsulfamic acid has a molecular weight of 237.36 g/mol, XLogP of 2.38, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyloctylsulfamic acid is sourced from PubChem (CID 87283491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).