About 5,6-difluoro-5-methoxycyclohexa-1,3-diene-1-carbaldehyde
5,6-difluoro-5-methoxycyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 87283530) has the molecular formula C8H8F2O2
and a molecular weight of 174.15 g/mol. Its IUPAC name is 5,6-difluoro-5-methoxycyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 5,6-difluoro-5-methoxycyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 87283530 |
| Molecular Formula | C8H8F2O2 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 5,6-difluoro-5-methoxycyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | COC1(F)C=CC=C(C=O)C1F |
| InChI | InChI=1S/C8H8F2O2/c1-12-8(10)4-2-3-6(5-11)7(8)9/h2-5,7H,1H3 |
| InChIKey | IFDSTBMSKDUIKV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5,6-difluoro-5-methoxycyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-difluoro-5-methoxycyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of 5,6-difluoro-5-methoxycyclohexa-1,3-diene-1-carbaldehyde (CID 87283530) is 5,6-difluoro-5-methoxycyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 5,6-difluoro-5-methoxycyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for 5,6-difluoro-5-methoxycyclohexa-1,3-diene-1-carbaldehyde is COC1(F)C=CC=C(C=O)C1F.
What is the InChIKey of 5,6-difluoro-5-methoxycyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is IFDSTBMSKDUIKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2O2/c1-12-8(10)4-2-3-6(5-11)7(8)9/h2-5,7H,1H3.
What are the key properties of 5,6-difluoro-5-methoxycyclohexa-1,3-diene-1-carbaldehyde?
5,6-difluoro-5-methoxycyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 174.15 g/mol, XLogP of 1.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-difluoro-5-methoxycyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 87283530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).