C36H43N4Pd- — CID 87284797
7,8,10,12,13,15,17,18-octaethyl-2H-porphyrin-2-ide;palladium (PubChem CID 87284797) has the molecular formula C36H43N4Pd- and a molecular weight of 638.19 g/mol. Its IUPAC name is 7,8,10,12,13,15,17,18-octaethyl-2H-porphyrin-2-ide;palladium.
| Compound Name | 7,8,10,12,13,15,17,18-octaethyl-2H-porphyrin-2-ide;palladium |
|---|---|
| PubChem CID | 87284797 |
| Molecular Formula | C36H43N4Pd- |
| Molecular Weight | 638.19 g/mol |
| Exact Mass | 637.25 |
| IUPAC Name | 7,8,10,12,13,15,17,18-octaethyl-2H-porphyrin-2-ide;palladium |
| SMILES | CCC1=C(CC)/C2=C/C3=N/C(=C\C4=N/C(=C(/CC)C5=N/C(=C(/CC)C1=N2)C(CC)=C5CC)C(CC)=C4CC)C=[C-]3.[Pd] |
| InChI | InChI=1S/C36H43N4.Pd/c1-9-23-25(11-3)33-29(15-7)35-27(13-5)28(14-6)36(40-35)30(16-8)34-26(12-4)24(10-2)32(39-34)20-22-18-17-21(37-22)19-31(23)38-33;/h17,19-20H,9-16H2,1-8H3;/q-1;/b21-19-,22-20-,31-19-,32-20-,33-29-,34-30-,35-29-,36-30-; |
| InChIKey | JGZFNNUHVBVNHU-JTJOWCOOSA-N |
| XLogP | 9.62 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.19 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|