C36H56P2 — CID 87284868
[1-(1-adamantyl)-1-[4-[1-(1-adamantyl)-2,2-dimethyl-1-phosphanylpropyl]phenyl]-2,2-dimethylpropyl]phosphane (PubChem CID 87284868) has the molecular formula C36H56P2 and a molecular weight of 550.79 g/mol. Its IUPAC name is [1-(1-adamantyl)-1-[4-[1-(1-adamantyl)-2,2-dimethyl-1-phosphanylpropyl]phenyl]-2,2-dimethylpropyl]phosphane.
| Compound Name | [1-(1-adamantyl)-1-[4-[1-(1-adamantyl)-2,2-dimethyl-1-phosphanylpropyl]phenyl]-2,2-dimethylpropyl]phosphane |
|---|---|
| PubChem CID | 87284868 |
| Molecular Formula | C36H56P2 |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.39 |
| IUPAC Name | [1-(1-adamantyl)-1-[4-[1-(1-adamantyl)-2,2-dimethyl-1-phosphanylpropyl]phenyl]-2,2-dimethylpropyl]phosphane |
| SMILES | CC(C)(C)C(P)(c1ccc(C(P)(C(C)(C)C)C23CC4CC(CC(C4)C2)C3)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C36H56P2/c1-31(2,3)35(37,33-17-23-11-24(18-33)13-25(12-23)19-33)29-7-9-30(10-8-29)36(38,32(4,5)6)34-20-26-14-27(21-34)16-28(15-26)22-34/h7-10,23-28H,11-22,37-38H2,1-6H3 |
| InChIKey | FEBOBZVXYZMDJM-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|