C27H50O3P2 — CID 87284896
ditert-butyl-[[(1S,2R)-3-methyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]cyclopentyl]methyl]phosphane (PubChem CID 87284896) has the molecular formula C27H50O3P2 and a molecular weight of 484.64 g/mol. Its IUPAC name is ditert-butyl-[[(1S,2R)-3-methyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]cyclopentyl]methyl]phosphane.
| Compound Name | ditert-butyl-[[(1S,2R)-3-methyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]cyclopentyl]methyl]phosphane |
|---|---|
| PubChem CID | 87284896 |
| Molecular Formula | C27H50O3P2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | ditert-butyl-[[(1S,2R)-3-methyl-2-[1,3,5,7-tetramethyl-8-(phosphanylmethyl)-2,4,6-trioxatricyclo[3.3.1.13,7]decan-8-yl]cyclopentyl]methyl]phosphane |
| SMILES | CC1CC[C@H](CP(C(C)(C)C)C(C)(C)C)[C@@H]1C1(CP)C2(C)CC3(C)OC(C)(CC1(C)O3)O2 |
| InChI | InChI=1S/C27H50O3P2/c1-18-12-13-19(14-32(21(2,3)4)22(5,6)7)20(18)27(17-31)23(8)15-25(10)29-24(27,9)16-26(11,28-23)30-25/h18-20H,12-17,31H2,1-11H3/t18?,19-,20-,23?,24?,25?,26?,27?/m1/s1 |
| InChIKey | IWKLHJYBSZNWNC-MPMVCJCPSA-N |
| XLogP | 7.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|