C13H22F4N2O3S — CID 87285109
1-heptyl-3-methylimidazol-3-ium;1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 87285109) has the molecular formula C13H22F4N2O3S and a molecular weight of 362.39 g/mol. Its IUPAC name is 1-heptyl-3-methylimidazol-3-ium;1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | 1-heptyl-3-methylimidazol-3-ium;1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 87285109 |
| Molecular Formula | C13H22F4N2O3S |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 1-heptyl-3-methylimidazol-3-ium;1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | CCCCCCCn1cc[n+](C)c1.O=S(=O)([O-])C(F)(F)C(F)F |
| InChI | InChI=1S/C11H21N2.C2H2F4O3S/c1-3-4-5-6-7-8-13-10-9-12(2)11-13;3-1(4)2(5,6)10(7,8)9/h9-11H,3-8H2,1-2H3;1H,(H,7,8,9)/q+1;/p-1 |
| InChIKey | VYJKCESBXIRRDM-UHFFFAOYSA-M |
| XLogP | 2.67 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|