C33H29F6N3O9S — CID 87285135
2-(2,6-dimethoxyphenyl)-N-[[3-methyl-4-[6-oxo-5,9-bis(2,2,2-trifluoroethoxy)-5,7,8,9-tetrahydropyrrolo[3,4-h]quinolin-7-yl]phenyl]methylsulfonyl]-2-oxoacetamide (PubChem CID 87285135) has the molecular formula C33H29F6N3O9S and a molecular weight of 757.66 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenyl)-N-[[3-methyl-4-[6-oxo-5,9-bis(2,2,2-trifluoroethoxy)-5,7,8,9-tetrahydropyrrolo[3,4-h]quinolin-7-yl]phenyl]methylsulfonyl]-2-oxoacetamide.
| Compound Name | 2-(2,6-dimethoxyphenyl)-N-[[3-methyl-4-[6-oxo-5,9-bis(2,2,2-trifluoroethoxy)-5,7,8,9-tetrahydropyrrolo[3,4-h]quinolin-7-yl]phenyl]methylsulfonyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 87285135 |
| Molecular Formula | C33H29F6N3O9S |
| Molecular Weight | 757.66 g/mol |
| Exact Mass | 757.15 |
| IUPAC Name | 2-(2,6-dimethoxyphenyl)-N-[[3-methyl-4-[6-oxo-5,9-bis(2,2,2-trifluoroethoxy)-5,7,8,9-tetrahydropyrrolo[3,4-h]quinolin-7-yl]phenyl]methylsulfonyl]-2-oxoacetamide |
| SMILES | COc1cccc(OC)c1C(=O)C(=O)NS(=O)(=O)Cc1ccc(C2NC(OCC(F)(F)F)C3=C2C(=O)C(OCC(F)(F)F)c2cccnc23)c(C)c1 |
| InChI | InChI=1S/C33H29F6N3O9S/c1-16-12-17(13-52(46,47)42-30(45)28(44)22-20(48-2)7-4-8-21(22)49-3)9-10-18(16)26-23-24(31(41-26)51-15-33(37,38)39)25-19(6-5-11-40-25)29(27(23)43)50-14-32(34,35)36/h4-12,26,29,31,41H,13-15H2,1-3H3,(H,42,45) |
| InChIKey | FZAFOJABPXSHNV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 159.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|