C9H12F6N2O3S — CID 87285145
1-ethyl-3-methylimidazol-3-ium;1,1,2,3,3,3-hexafluoropropane-1-sulfonate (PubChem CID 87285145) has the molecular formula C9H12F6N2O3S and a molecular weight of 342.26 g/mol. Its IUPAC name is 1-ethyl-3-methylimidazol-3-ium;1,1,2,3,3,3-hexafluoropropane-1-sulfonate.
| Compound Name | 1-ethyl-3-methylimidazol-3-ium;1,1,2,3,3,3-hexafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 87285145 |
| Molecular Formula | C9H12F6N2O3S |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 1-ethyl-3-methylimidazol-3-ium;1,1,2,3,3,3-hexafluoropropane-1-sulfonate |
| SMILES | CCn1cc[n+](C)c1.O=S(=O)([O-])C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C6H11N2.C3H2F6O3S/c1-3-8-5-4-7(2)6-8;4-1(2(5,6)7)3(8,9)13(10,11)12/h4-6H,3H2,1-2H3;1H,(H,10,11,12)/q+1;/p-1 |
| InChIKey | SEGKWNUGNNFXPC-UHFFFAOYSA-M |
| XLogP | 1.36 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|