About (3-hydroxy-1-adamantyl)methoxycarbonyl difluoromethanesulfonate;triphenylsulfanium
(3-hydroxy-1-adamantyl)methoxycarbonyl difluoromethanesulfonate;triphenylsulfanium (PubChem CID 87285431) has the molecular formula C31H33F2O6S2+
and a molecular weight of 603.73 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl)methoxycarbonyl difluoromethanesulfonate;triphenylsulfanium.
Molecular Properties
| Compound Name | (3-hydroxy-1-adamantyl)methoxycarbonyl difluoromethanesulfonate;triphenylsulfanium |
| PubChem CID | 87285431 |
| Molecular Formula | C31H33F2O6S2+ |
| Molecular Weight | 603.73 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | (3-hydroxy-1-adamantyl)methoxycarbonyl difluoromethanesulfonate;triphenylsulfanium |
| SMILES | O=C(OCC12CC3CC(CC(O)(C3)C1)C2)OS(=O)(=O)C(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C13H18F2O6S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;14-10(15)22(18,19)21-11(16)20-7-12-2-8-1-9(3-12)5-13(17,4-8)6-12/h1-15H;8-10,17H,1-7H2/q+1; |
| InChIKey | AGRPXHBZUZKSKX-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 603.73 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-1-adamantyl)methoxycarbonyl difluoromethanesulfonate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-1-adamantyl)methoxycarbonyl difluoromethanesulfonate;triphenylsulfanium?
The IUPAC name of (3-hydroxy-1-adamantyl)methoxycarbonyl difluoromethanesulfonate;triphenylsulfanium (CID 87285431) is (3-hydroxy-1-adamantyl)methoxycarbonyl difluoromethanesulfonate;triphenylsulfanium.
What is the SMILES notation for (3-hydroxy-1-adamantyl)methoxycarbonyl difluoromethanesulfonate;triphenylsulfanium?
The canonical SMILES for (3-hydroxy-1-adamantyl)methoxycarbonyl difluoromethanesulfonate;triphenylsulfanium is O=C(OCC12CC3CC(CC(O)(C3)C1)C2)OS(=O)(=O)C(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (3-hydroxy-1-adamantyl)methoxycarbonyl difluoromethanesulfonate;triphenylsulfanium?
The InChIKey is AGRPXHBZUZKSKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15S.C13H18F2O6S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;14-10(15)22(18,19)21-11(16)20-7-12-2-8-1-9(3-12)5-13(17,4-8)6-12/h1-15H;8-10,17H,1-7H2/q+1;.
What are the key properties of (3-hydroxy-1-adamantyl)methoxycarbonyl difluoromethanesulfonate;triphenylsulfanium?
(3-hydroxy-1-adamantyl)methoxycarbonyl difluoromethanesulfonate;triphenylsulfanium has a molecular weight of 603.73 g/mol, XLogP of 6.81, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-1-adamantyl)methoxycarbonyl difluoromethanesulfonate;triphenylsulfanium is sourced from PubChem (CID 87285431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).