About lithium;(E,2S)-2-[tert-butyl(dimethyl)silyl]oxyoct-4-en-3-one;chloride
lithium;(E,2S)-2-[tert-butyl(dimethyl)silyl]oxyoct-4-en-3-one;chloride (PubChem CID 87285608) has the molecular formula C14H28ClLiO2Si
and a molecular weight of 298.86 g/mol. Its IUPAC name is lithium;(E,2S)-2-[tert-butyl(dimethyl)silyl]oxyoct-4-en-3-one;chloride.
Molecular Properties
| Compound Name | lithium;(E,2S)-2-[tert-butyl(dimethyl)silyl]oxyoct-4-en-3-one;chloride |
| PubChem CID | 87285608 |
| Molecular Formula | C14H28ClLiO2Si |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | lithium;(E,2S)-2-[tert-butyl(dimethyl)silyl]oxyoct-4-en-3-one;chloride |
| SMILES | CCC/C=C/C(=O)[C@H](C)O[Si](C)(C)C(C)(C)C.[Cl-].[Li+] |
| InChI | InChI=1S/C14H28O2Si.ClH.Li/c1-8-9-10-11-13(15)12(2)16-17(6,7)14(3,4)5;;/h10-12H,8-9H2,1-7H3;1H;/q;;+1/p-1/b11-10+;;/t12-;;/m0../s1 |
| InChIKey | GUKUBTUDQOHKOO-ALCUURHYSA-M |
| XLogP | -1.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze lithium;(E,2S)-2-[tert-butyl(dimethyl)silyl]oxyoct-4-en-3-one;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;(E,2S)-2-[tert-butyl(dimethyl)silyl]oxyoct-4-en-3-one;chloride?
The IUPAC name of lithium;(E,2S)-2-[tert-butyl(dimethyl)silyl]oxyoct-4-en-3-one;chloride (CID 87285608) is lithium;(E,2S)-2-[tert-butyl(dimethyl)silyl]oxyoct-4-en-3-one;chloride.
What is the SMILES notation for lithium;(E,2S)-2-[tert-butyl(dimethyl)silyl]oxyoct-4-en-3-one;chloride?
The canonical SMILES for lithium;(E,2S)-2-[tert-butyl(dimethyl)silyl]oxyoct-4-en-3-one;chloride is CCC/C=C/C(=O)[C@H](C)O[Si](C)(C)C(C)(C)C.[Cl-].[Li+].
What is the InChIKey of lithium;(E,2S)-2-[tert-butyl(dimethyl)silyl]oxyoct-4-en-3-one;chloride?
The InChIKey is GUKUBTUDQOHKOO-ALCUURHYSA-M. The full InChI is InChI=1S/C14H28O2Si.ClH.Li/c1-8-9-10-11-13(15)12(2)16-17(6,7)14(3,4)5;;/h10-12H,8-9H2,1-7H3;1H;/q;;+1/p-1/b11-10+;;/t12-;;/m0../s1.
What are the key properties of lithium;(E,2S)-2-[tert-butyl(dimethyl)silyl]oxyoct-4-en-3-one;chloride?
lithium;(E,2S)-2-[tert-butyl(dimethyl)silyl]oxyoct-4-en-3-one;chloride has a molecular weight of 298.86 g/mol, XLogP of -1.67, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;(E,2S)-2-[tert-butyl(dimethyl)silyl]oxyoct-4-en-3-one;chloride is sourced from PubChem (CID 87285608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).