C22H20N4O2 — CID 87285634
2-[2,6-dimethyl-4-[5-(1-methyl-5-phenylpyrazol-3-yl)-1,3,4-oxadiazol-2-yl]phenyl]acetaldehyde (PubChem CID 87285634) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-[2,6-dimethyl-4-[5-(1-methyl-5-phenylpyrazol-3-yl)-1,3,4-oxadiazol-2-yl]phenyl]acetaldehyde.
| Compound Name | 2-[2,6-dimethyl-4-[5-(1-methyl-5-phenylpyrazol-3-yl)-1,3,4-oxadiazol-2-yl]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 87285634 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-[2,6-dimethyl-4-[5-(1-methyl-5-phenylpyrazol-3-yl)-1,3,4-oxadiazol-2-yl]phenyl]acetaldehyde |
| SMILES | Cc1cc(-c2nnc(-c3cc(-c4ccccc4)n(C)n3)o2)cc(C)c1CC=O |
| InChI | InChI=1S/C22H20N4O2/c1-14-11-17(12-15(2)18(14)9-10-27)21-23-24-22(28-21)19-13-20(26(3)25-19)16-7-5-4-6-8-16/h4-8,10-13H,9H2,1-3H3 |
| InChIKey | SUMUKEVKMDYMJT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|