About azane;2,3-dimethylpent-2-ene
azane;2,3-dimethylpent-2-ene (PubChem CID 87285665) has the molecular formula C7H17N
and a molecular weight of 115.22 g/mol. Its IUPAC name is azane;2,3-dimethylpent-2-ene.
Molecular Properties
| Compound Name | azane;2,3-dimethylpent-2-ene |
| PubChem CID | 87285665 |
| Molecular Formula | C7H17N |
| Molecular Weight | 115.22 g/mol |
| Exact Mass | 115.14 |
| IUPAC Name | azane;2,3-dimethylpent-2-ene |
| SMILES | CCC(C)=C(C)C.N |
| InChI | InChI=1S/C7H14.H3N/c1-5-7(4)6(2)3;/h5H2,1-4H3;1H3 |
| InChIKey | AWSBAPPEWXRHBH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;2,3-dimethylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2,3-dimethylpent-2-ene?
The IUPAC name of azane;2,3-dimethylpent-2-ene (CID 87285665) is azane;2,3-dimethylpent-2-ene.
What is the SMILES notation for azane;2,3-dimethylpent-2-ene?
The canonical SMILES for azane;2,3-dimethylpent-2-ene is CCC(C)=C(C)C.N.
What is the InChIKey of azane;2,3-dimethylpent-2-ene?
The InChIKey is AWSBAPPEWXRHBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14.H3N/c1-5-7(4)6(2)3;/h5H2,1-4H3;1H3.
What are the key properties of azane;2,3-dimethylpent-2-ene?
azane;2,3-dimethylpent-2-ene has a molecular weight of 115.22 g/mol, XLogP of 2.91, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2,3-dimethylpent-2-ene is sourced from PubChem (CID 87285665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).