C24H24O21 — CID 87285781
2,3,4,5-tetrakis(2-acetyloxy-2-oxoethyl)oxolane-2,3,4,5-tetracarboxylic acid (PubChem CID 87285781) has the molecular formula C24H24O21 and a molecular weight of 648.44 g/mol. Its IUPAC name is 2,3,4,5-tetrakis(2-acetyloxy-2-oxoethyl)oxolane-2,3,4,5-tetracarboxylic acid.
| Compound Name | 2,3,4,5-tetrakis(2-acetyloxy-2-oxoethyl)oxolane-2,3,4,5-tetracarboxylic acid |
|---|---|
| PubChem CID | 87285781 |
| Molecular Formula | C24H24O21 |
| Molecular Weight | 648.44 g/mol |
| Exact Mass | 648.08 |
| IUPAC Name | 2,3,4,5-tetrakis(2-acetyloxy-2-oxoethyl)oxolane-2,3,4,5-tetracarboxylic acid |
| SMILES | CC(=O)OC(=O)CC1(C(=O)O)OC(CC(=O)OC(C)=O)(C(=O)O)C(CC(=O)OC(C)=O)(C(=O)O)C1(CC(=O)OC(C)=O)C(=O)O |
| InChI | InChI=1S/C24H24O21/c1-9(25)41-13(29)5-21(17(33)34)22(18(35)36,6-14(30)42-10(2)26)24(20(39)40,8-16(32)44-12(4)28)45-23(21,19(37)38)7-15(31)43-11(3)27/h5-8H2,1-4H3,(H,33,34)(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | WSWCZELIOFEDBA-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 331.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.44 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|