About methanesulfonate;prop-2-enylazanium
methanesulfonate;prop-2-enylazanium (PubChem CID 87286063) has the molecular formula C4H11NO3S
and a molecular weight of 153.20 g/mol. Its IUPAC name is methanesulfonate;prop-2-enylazanium.
Molecular Properties
| Compound Name | methanesulfonate;prop-2-enylazanium |
| PubChem CID | 87286063 |
| Molecular Formula | C4H11NO3S |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | methanesulfonate;prop-2-enylazanium |
| SMILES | C=CC[NH3+].CS(=O)(=O)[O-] |
| InChI | InChI=1S/C3H7N.CH4O3S/c1-2-3-4;1-5(2,3)4/h2H,1,3-4H2;1H3,(H,2,3,4) |
| InChIKey | IYOFHXBWZYWKRG-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonate;prop-2-enylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonate;prop-2-enylazanium?
The IUPAC name of methanesulfonate;prop-2-enylazanium (CID 87286063) is methanesulfonate;prop-2-enylazanium.
What is the SMILES notation for methanesulfonate;prop-2-enylazanium?
The canonical SMILES for methanesulfonate;prop-2-enylazanium is C=CC[NH3+].CS(=O)(=O)[O-].
What is the InChIKey of methanesulfonate;prop-2-enylazanium?
The InChIKey is IYOFHXBWZYWKRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N.CH4O3S/c1-2-3-4;1-5(2,3)4/h2H,1,3-4H2;1H3,(H,2,3,4).
What are the key properties of methanesulfonate;prop-2-enylazanium?
methanesulfonate;prop-2-enylazanium has a molecular weight of 153.20 g/mol, XLogP of -1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonate;prop-2-enylazanium is sourced from PubChem (CID 87286063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).