About 1,1-dimethoxyethane;N,N-dimethylformamide;methylsulfinylmethane
1,1-dimethoxyethane;N,N-dimethylformamide;methylsulfinylmethane (PubChem CID 87286102) has the molecular formula C9H23NO4S
and a molecular weight of 241.35 g/mol. Its IUPAC name is 1,1-dimethoxyethane;N,N-dimethylformamide;methylsulfinylmethane.
Molecular Properties
| Compound Name | 1,1-dimethoxyethane;N,N-dimethylformamide;methylsulfinylmethane |
| PubChem CID | 87286102 |
| Molecular Formula | C9H23NO4S |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 1,1-dimethoxyethane;N,N-dimethylformamide;methylsulfinylmethane |
| SMILES | CN(C)C=O.COC(C)OC.CS(C)=O |
| InChI | InChI=1S/C4H10O2.C3H7NO.C2H6OS/c1-4(5-2)6-3;1-4(2)3-5;1-4(2)3/h4H,1-3H3;3H,1-2H3;1-2H3 |
| InChIKey | HVNMYWNMRJOJRL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxyethane;N,N-dimethylformamide;methylsulfinylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxyethane;N,N-dimethylformamide;methylsulfinylmethane?
The IUPAC name of 1,1-dimethoxyethane;N,N-dimethylformamide;methylsulfinylmethane (CID 87286102) is 1,1-dimethoxyethane;N,N-dimethylformamide;methylsulfinylmethane.
What is the SMILES notation for 1,1-dimethoxyethane;N,N-dimethylformamide;methylsulfinylmethane?
The canonical SMILES for 1,1-dimethoxyethane;N,N-dimethylformamide;methylsulfinylmethane is CN(C)C=O.COC(C)OC.CS(C)=O.
What is the InChIKey of 1,1-dimethoxyethane;N,N-dimethylformamide;methylsulfinylmethane?
The InChIKey is HVNMYWNMRJOJRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.C3H7NO.C2H6OS/c1-4(5-2)6-3;1-4(2)3-5;1-4(2)3/h4H,1-3H3;3H,1-2H3;1-2H3.
What are the key properties of 1,1-dimethoxyethane;N,N-dimethylformamide;methylsulfinylmethane?
1,1-dimethoxyethane;N,N-dimethylformamide;methylsulfinylmethane has a molecular weight of 241.35 g/mol, XLogP of 0.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxyethane;N,N-dimethylformamide;methylsulfinylmethane is sourced from PubChem (CID 87286102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).