C19H42O3Si2 — CID 87286880
(2R,3R,4R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylpentanal (PubChem CID 87286880) has the molecular formula C19H42O3Si2 and a molecular weight of 374.71 g/mol. Its IUPAC name is (2R,3R,4R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylpentanal.
| Compound Name | (2R,3R,4R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylpentanal |
|---|---|
| PubChem CID | 87286880 |
| Molecular Formula | C19H42O3Si2 |
| Molecular Weight | 374.71 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | (2R,3R,4R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylpentanal |
| SMILES | CC(C=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H42O3Si2/c1-15(13-20)17(22-24(11,12)19(6,7)8)16(2)14-21-23(9,10)18(3,4)5/h13,15-17H,14H2,1-12H3/t15?,16-,17+/m1/s1 |
| InChIKey | OZORUITXYNYBII-FGJGXXMFSA-N |
| XLogP | 5.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.71 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|