About N'-tert-butylethane-1,2-disulfonamide
N'-tert-butylethane-1,2-disulfonamide (PubChem CID 87286911) has the molecular formula C6H16N2O4S2
and a molecular weight of 244.34 g/mol. Its IUPAC name is N'-tert-butylethane-1,2-disulfonamide.
Molecular Properties
| Compound Name | N'-tert-butylethane-1,2-disulfonamide |
| PubChem CID | 87286911 |
| Molecular Formula | C6H16N2O4S2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | N'-tert-butylethane-1,2-disulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)CCS(N)(=O)=O |
| InChI | InChI=1S/C6H16N2O4S2/c1-6(2,3)8-14(11,12)5-4-13(7,9)10/h8H,4-5H2,1-3H3,(H2,7,9,10) |
| InChIKey | DFQDMSGFMBKTJD-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-tert-butylethane-1,2-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-tert-butylethane-1,2-disulfonamide?
The IUPAC name of N'-tert-butylethane-1,2-disulfonamide (CID 87286911) is N'-tert-butylethane-1,2-disulfonamide.
What is the SMILES notation for N'-tert-butylethane-1,2-disulfonamide?
The canonical SMILES for N'-tert-butylethane-1,2-disulfonamide is CC(C)(C)NS(=O)(=O)CCS(N)(=O)=O.
What is the InChIKey of N'-tert-butylethane-1,2-disulfonamide?
The InChIKey is DFQDMSGFMBKTJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2O4S2/c1-6(2,3)8-14(11,12)5-4-13(7,9)10/h8H,4-5H2,1-3H3,(H2,7,9,10).
What are the key properties of N'-tert-butylethane-1,2-disulfonamide?
N'-tert-butylethane-1,2-disulfonamide has a molecular weight of 244.34 g/mol, XLogP of -1.01, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-tert-butylethane-1,2-disulfonamide is sourced from PubChem (CID 87286911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).