C19H44O3Si2 — CID 87286984
(2R,3R,4R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylpentan-1-ol (PubChem CID 87286984) has the molecular formula C19H44O3Si2 and a molecular weight of 376.73 g/mol. Its IUPAC name is (2R,3R,4R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylpentan-1-ol.
| Compound Name | (2R,3R,4R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 87286984 |
| Molecular Formula | C19H44O3Si2 |
| Molecular Weight | 376.73 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | (2R,3R,4R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylpentan-1-ol |
| SMILES | C[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H44O3Si2/c1-15(13-20)17(22-24(11,12)19(6,7)8)16(2)14-21-23(9,10)18(3,4)5/h15-17,20H,13-14H2,1-12H3/t15-,16-,17-/m1/s1 |
| InChIKey | KKIRRYAMSYGFBP-BRWVUGGUSA-N |
| XLogP | 5.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.73 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|