About 3,4-dibenzoyl-3,4-dihydroxyoxolane-2,5-dione
3,4-dibenzoyl-3,4-dihydroxyoxolane-2,5-dione (PubChem CID 87286986) has the molecular formula C18H12O7
and a molecular weight of 340.29 g/mol. Its IUPAC name is 3,4-dibenzoyl-3,4-dihydroxyoxolane-2,5-dione.
Molecular Properties
| Compound Name | 3,4-dibenzoyl-3,4-dihydroxyoxolane-2,5-dione |
| PubChem CID | 87286986 |
| Molecular Formula | C18H12O7 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 3,4-dibenzoyl-3,4-dihydroxyoxolane-2,5-dione |
| SMILES | O=C1OC(=O)C(O)(C(=O)c2ccccc2)C1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H12O7/c19-13(11-7-3-1-4-8-11)17(23)15(21)25-16(22)18(17,24)14(20)12-9-5-2-6-10-12/h1-10,23-24H |
| InChIKey | VZRYBASZQOAJKO-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dibenzoyl-3,4-dihydroxyoxolane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibenzoyl-3,4-dihydroxyoxolane-2,5-dione?
The IUPAC name of 3,4-dibenzoyl-3,4-dihydroxyoxolane-2,5-dione (CID 87286986) is 3,4-dibenzoyl-3,4-dihydroxyoxolane-2,5-dione.
What is the SMILES notation for 3,4-dibenzoyl-3,4-dihydroxyoxolane-2,5-dione?
The canonical SMILES for 3,4-dibenzoyl-3,4-dihydroxyoxolane-2,5-dione is O=C1OC(=O)C(O)(C(=O)c2ccccc2)C1(O)C(=O)c1ccccc1.
What is the InChIKey of 3,4-dibenzoyl-3,4-dihydroxyoxolane-2,5-dione?
The InChIKey is VZRYBASZQOAJKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O7/c19-13(11-7-3-1-4-8-11)17(23)15(21)25-16(22)18(17,24)14(20)12-9-5-2-6-10-12/h1-10,23-24H.
What are the key properties of 3,4-dibenzoyl-3,4-dihydroxyoxolane-2,5-dione?
3,4-dibenzoyl-3,4-dihydroxyoxolane-2,5-dione has a molecular weight of 340.29 g/mol, XLogP of 0.30, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibenzoyl-3,4-dihydroxyoxolane-2,5-dione is sourced from PubChem (CID 87286986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).