C29H62O5Si3 — CID 87286989
ethyl (4R,5S,7S)-5,7,8-tris[[tert-butyl(dimethyl)silyl]oxy]-4-methyloct-2-enoate (PubChem CID 87286989) has the molecular formula C29H62O5Si3 and a molecular weight of 575.07 g/mol. Its IUPAC name is ethyl (4R,5S,7S)-5,7,8-tris[[tert-butyl(dimethyl)silyl]oxy]-4-methyloct-2-enoate.
| Compound Name | ethyl (4R,5S,7S)-5,7,8-tris[[tert-butyl(dimethyl)silyl]oxy]-4-methyloct-2-enoate |
|---|---|
| PubChem CID | 87286989 |
| Molecular Formula | C29H62O5Si3 |
| Molecular Weight | 575.07 g/mol |
| Exact Mass | 574.39 |
| IUPAC Name | ethyl (4R,5S,7S)-5,7,8-tris[[tert-butyl(dimethyl)silyl]oxy]-4-methyloct-2-enoate |
| SMILES | CCOC(=O)C=C[C@@H](C)[C@H](C[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H62O5Si3/c1-18-31-26(30)20-19-23(2)25(34-37(16,17)29(9,10)11)21-24(33-36(14,15)28(6,7)8)22-32-35(12,13)27(3,4)5/h19-20,23-25H,18,21-22H2,1-17H3/t23-,24+,25+/m1/s1 |
| InChIKey | KOCZRMIUNVKWHR-DSITVLBTSA-N |
| XLogP | 8.93 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.07 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|