About 1-ethenoxy-3-(ethenoxymethyl)-5-methoxy-2,5-dimethylhexane
1-ethenoxy-3-(ethenoxymethyl)-5-methoxy-2,5-dimethylhexane (PubChem CID 87287194) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-ethenoxy-3-(ethenoxymethyl)-5-methoxy-2,5-dimethylhexane.
Molecular Properties
| Compound Name | 1-ethenoxy-3-(ethenoxymethyl)-5-methoxy-2,5-dimethylhexane |
| PubChem CID | 87287194 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 1-ethenoxy-3-(ethenoxymethyl)-5-methoxy-2,5-dimethylhexane |
| SMILES | C=COCC(C)C(COC=C)CC(C)(C)OC |
| InChI | InChI=1S/C14H26O3/c1-7-16-10-12(3)13(11-17-8-2)9-14(4,5)15-6/h7-8,12-13H,1-2,9-11H2,3-6H3 |
| InChIKey | NVESKNUWOKQFHY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenoxy-3-(ethenoxymethyl)-5-methoxy-2,5-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenoxy-3-(ethenoxymethyl)-5-methoxy-2,5-dimethylhexane?
The IUPAC name of 1-ethenoxy-3-(ethenoxymethyl)-5-methoxy-2,5-dimethylhexane (CID 87287194) is 1-ethenoxy-3-(ethenoxymethyl)-5-methoxy-2,5-dimethylhexane.
What is the SMILES notation for 1-ethenoxy-3-(ethenoxymethyl)-5-methoxy-2,5-dimethylhexane?
The canonical SMILES for 1-ethenoxy-3-(ethenoxymethyl)-5-methoxy-2,5-dimethylhexane is C=COCC(C)C(COC=C)CC(C)(C)OC.
What is the InChIKey of 1-ethenoxy-3-(ethenoxymethyl)-5-methoxy-2,5-dimethylhexane?
The InChIKey is NVESKNUWOKQFHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-7-16-10-12(3)13(11-17-8-2)9-14(4,5)15-6/h7-8,12-13H,1-2,9-11H2,3-6H3.
What are the key properties of 1-ethenoxy-3-(ethenoxymethyl)-5-methoxy-2,5-dimethylhexane?
1-ethenoxy-3-(ethenoxymethyl)-5-methoxy-2,5-dimethylhexane has a molecular weight of 242.36 g/mol, XLogP of 3.37, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenoxy-3-(ethenoxymethyl)-5-methoxy-2,5-dimethylhexane is sourced from PubChem (CID 87287194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).